C23H26O6 — CID 162753420
2-[2-(2-hydroxypropan-2-yloxy)ethyl]-3,4-bis(phenylmethoxy)-2H-furan-5-one (PubChem CID 162753420) has the molecular formula C23H26O6 and a molecular weight of 398.46 g/mol. Its IUPAC name is 2-[2-(2-hydroxypropan-2-yloxy)ethyl]-3,4-bis(phenylmethoxy)-2H-furan-5-one.
| Compound Name | 2-[2-(2-hydroxypropan-2-yloxy)ethyl]-3,4-bis(phenylmethoxy)-2H-furan-5-one |
|---|---|
| PubChem CID | 162753420 |
| Molecular Formula | C23H26O6 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | 2-[2-(2-hydroxypropan-2-yloxy)ethyl]-3,4-bis(phenylmethoxy)-2H-furan-5-one |
| SMILES | CC(C)(O)OCCC1OC(=O)C(OCc2ccccc2)=C1OCc1ccccc1 |
| InChI | InChI=1S/C23H26O6/c1-23(2,25)28-14-13-19-20(26-15-17-9-5-3-6-10-17)21(22(24)29-19)27-16-18-11-7-4-8-12-18/h3-12,19,25H,13-16H2,1-2H3 |
| InChIKey | XUVACFLBMLLGSW-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|