C19H28O6Si — CID 173259006
2-(1,2-dihydroxyethyl)-4-(2,3-dimethyl-4-silylbutan-2-yl)oxy-3-phenylmethoxy-2H-furan-5-one (PubChem CID 173259006) has the molecular formula C19H28O6Si and a molecular weight of 380.51 g/mol. Its IUPAC name is 2-(1,2-dihydroxyethyl)-4-(2,3-dimethyl-4-silylbutan-2-yl)oxy-3-phenylmethoxy-2H-furan-5-one.
| Compound Name | 2-(1,2-dihydroxyethyl)-4-(2,3-dimethyl-4-silylbutan-2-yl)oxy-3-phenylmethoxy-2H-furan-5-one |
|---|---|
| PubChem CID | 173259006 |
| Molecular Formula | C19H28O6Si |
| Molecular Weight | 380.51 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | 2-(1,2-dihydroxyethyl)-4-(2,3-dimethyl-4-silylbutan-2-yl)oxy-3-phenylmethoxy-2H-furan-5-one |
| SMILES | CC(C[SiH3])C(C)(C)OC1=C(OCc2ccccc2)C(C(O)CO)OC1=O |
| InChI | InChI=1S/C19H28O6Si/c1-12(11-26)19(2,3)25-17-16(15(14(21)9-20)24-18(17)22)23-10-13-7-5-4-6-8-13/h4-8,12,14-15,20-21H,9-11H2,1-3,26H3 |
| InChIKey | LJHKEOJSEAMTFT-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.51 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|