C32H41N3O5 — CID 155534038
(2R)-2-[(1S)-2-(4-decyltriazol-1-yl)-1-hydroxyethyl]-3,4-bis(phenylmethoxy)-2H-furan-5-one (PubChem CID 155534038) has the molecular formula C32H41N3O5 and a molecular weight of 547.70 g/mol. Its IUPAC name is (2R)-2-[(1S)-2-(4-decyltriazol-1-yl)-1-hydroxyethyl]-3,4-bis(phenylmethoxy)-2H-furan-5-one.
| Compound Name | (2R)-2-[(1S)-2-(4-decyltriazol-1-yl)-1-hydroxyethyl]-3,4-bis(phenylmethoxy)-2H-furan-5-one |
|---|---|
| PubChem CID | 155534038 |
| Molecular Formula | C32H41N3O5 |
| Molecular Weight | 547.70 g/mol |
| Exact Mass | 547.30 |
| IUPAC Name | (2R)-2-[(1S)-2-(4-decyltriazol-1-yl)-1-hydroxyethyl]-3,4-bis(phenylmethoxy)-2H-furan-5-one |
| SMILES | CCCCCCCCCCc1cn(C[C@H](O)[C@H]2OC(=O)C(OCc3ccccc3)=C2OCc2ccccc2)nn1 |
| InChI | InChI=1S/C32H41N3O5/c1-2-3-4-5-6-7-8-15-20-27-21-35(34-33-27)22-28(36)29-30(38-23-25-16-11-9-12-17-25)31(32(37)40-29)39-24-26-18-13-10-14-19-26/h9-14,16-19,21,28-29,36H,2-8,15,20,22-24H2,1H3/t28-,29+/m0/s1 |
| InChIKey | OODVVWXCMUDRDG-URLMMPGGSA-N |
| XLogP | 5.89 |
| TPSA | 95.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.70 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|