C27H29N3O4 — CID 90682869
(5Z)-5-[2-(4-pentyltriazol-1-yl)ethylidene]-3,4-bis(phenylmethoxy)furan-2-one (PubChem CID 90682869) has the molecular formula C27H29N3O4 and a molecular weight of 459.55 g/mol. Its IUPAC name is (5Z)-5-[2-(4-pentyltriazol-1-yl)ethylidene]-3,4-bis(phenylmethoxy)furan-2-one.
| Compound Name | (5Z)-5-[2-(4-pentyltriazol-1-yl)ethylidene]-3,4-bis(phenylmethoxy)furan-2-one |
|---|---|
| PubChem CID | 90682869 |
| Molecular Formula | C27H29N3O4 |
| Molecular Weight | 459.55 g/mol |
| Exact Mass | 459.22 |
| IUPAC Name | (5Z)-5-[2-(4-pentyltriazol-1-yl)ethylidene]-3,4-bis(phenylmethoxy)furan-2-one |
| SMILES | CCCCCc1cn(C/C=C2\OC(=O)C(OCc3ccccc3)=C2OCc2ccccc2)nn1 |
| InChI | InChI=1S/C27H29N3O4/c1-2-3-6-15-23-18-30(29-28-23)17-16-24-25(32-19-21-11-7-4-8-12-21)26(27(31)34-24)33-20-22-13-9-5-10-14-22/h4-5,7-14,16,18H,2-3,6,15,17,19-20H2,1H3/b24-16- |
| InChIKey | XTSDDGKYCBJVJL-JLPGSUDCSA-N |
| XLogP | 5.10 |
| TPSA | 75.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.55 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|