C30H29O9PS2 — CID 78056578
dibenzyl [2-hydroxy-1-[5-oxo-3,4-bis(thiophen-3-ylmethoxy)-2H-furan-2-yl]ethyl] phosphate (PubChem CID 78056578) has the molecular formula C30H29O9PS2 and a molecular weight of 628.66 g/mol. Its IUPAC name is dibenzyl [2-hydroxy-1-[5-oxo-3,4-bis(thiophen-3-ylmethoxy)-2H-furan-2-yl]ethyl] phosphate.
| Compound Name | dibenzyl [2-hydroxy-1-[5-oxo-3,4-bis(thiophen-3-ylmethoxy)-2H-furan-2-yl]ethyl] phosphate |
|---|---|
| PubChem CID | 78056578 |
| Molecular Formula | C30H29O9PS2 |
| Molecular Weight | 628.66 g/mol |
| Exact Mass | 628.10 |
| IUPAC Name | dibenzyl [2-hydroxy-1-[5-oxo-3,4-bis(thiophen-3-ylmethoxy)-2H-furan-2-yl]ethyl] phosphate |
| SMILES | O=C1OC(C(CO)OP(=O)(OCc2ccccc2)OCc2ccccc2)C(OCc2ccsc2)=C1OCc1ccsc1 |
| InChI | InChI=1S/C30H29O9PS2/c31-15-26(39-40(33,36-18-22-7-3-1-4-8-22)37-19-23-9-5-2-6-10-23)27-28(34-16-24-11-13-41-20-24)29(30(32)38-27)35-17-25-12-14-42-21-25/h1-14,20-21,26-27,31H,15-19H2 |
| InChIKey | UMXSUAIYUAGGPW-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 109.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.66 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|