C34H37O9P — CID 123812454
dibenzyl [1-(3-hepta-3,5-dienoxy-5-oxo-4-phenylmethoxy-2H-furan-2-yl)-2-hydroxyethyl] phosphate (PubChem CID 123812454) has the molecular formula C34H37O9P and a molecular weight of 620.64 g/mol. Its IUPAC name is dibenzyl [1-(3-hepta-3,5-dienoxy-5-oxo-4-phenylmethoxy-2H-furan-2-yl)-2-hydroxyethyl] phosphate.
| Compound Name | dibenzyl [1-(3-hepta-3,5-dienoxy-5-oxo-4-phenylmethoxy-2H-furan-2-yl)-2-hydroxyethyl] phosphate |
|---|---|
| PubChem CID | 123812454 |
| Molecular Formula | C34H37O9P |
| Molecular Weight | 620.64 g/mol |
| Exact Mass | 620.22 |
| IUPAC Name | dibenzyl [1-(3-hepta-3,5-dienoxy-5-oxo-4-phenylmethoxy-2H-furan-2-yl)-2-hydroxyethyl] phosphate |
| SMILES | CC=CC=CCCOC1=C(OCc2ccccc2)C(=O)OC1C(CO)OP(=O)(OCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C34H37O9P/c1-2-3-4-5-15-22-38-32-31(42-34(36)33(32)39-24-27-16-9-6-10-17-27)30(23-35)43-44(37,40-25-28-18-11-7-12-19-28)41-26-29-20-13-8-14-21-29/h2-14,16-21,30-31,35H,15,22-26H2,1H3 |
| InChIKey | YZHPZSVUKMONOD-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 109.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.64 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|