C36H37O11P — CID 78056592
dibenzyl [1-[3,4-bis[(3-methoxyphenyl)methoxy]-5-oxo-2H-furan-2-yl]-2-hydroxyethyl] phosphate (PubChem CID 78056592) has the molecular formula C36H37O11P and a molecular weight of 676.66 g/mol. Its IUPAC name is dibenzyl [1-[3,4-bis[(3-methoxyphenyl)methoxy]-5-oxo-2H-furan-2-yl]-2-hydroxyethyl] phosphate.
| Compound Name | dibenzyl [1-[3,4-bis[(3-methoxyphenyl)methoxy]-5-oxo-2H-furan-2-yl]-2-hydroxyethyl] phosphate |
|---|---|
| PubChem CID | 78056592 |
| Molecular Formula | C36H37O11P |
| Molecular Weight | 676.66 g/mol |
| Exact Mass | 676.21 |
| IUPAC Name | dibenzyl [1-[3,4-bis[(3-methoxyphenyl)methoxy]-5-oxo-2H-furan-2-yl]-2-hydroxyethyl] phosphate |
| SMILES | COc1cccc(COC2=C(OCc3cccc(OC)c3)C(C(CO)OP(=O)(OCc3ccccc3)OCc3ccccc3)OC2=O)c1 |
| InChI | InChI=1S/C36H37O11P/c1-40-30-17-9-15-28(19-30)22-42-34-33(46-36(38)35(34)43-23-29-16-10-18-31(20-29)41-2)32(21-37)47-48(39,44-24-26-11-5-3-6-12-26)45-25-27-13-7-4-8-14-27/h3-20,32-33,37H,21-25H2,1-2H3 |
| InChIKey | ZHZLJJQDPQDOIJ-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 128.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.66 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|