C34H31N2O13P — CID 71609408
dibenzyl [(1S)-1-[(2R)-3,4-bis[(3-nitrophenyl)methoxy]-5-oxo-2H-furan-2-yl]-2-hydroxyethyl] phosphate (PubChem CID 71609408) has the molecular formula C34H31N2O13P and a molecular weight of 706.60 g/mol. Its IUPAC name is dibenzyl [(1S)-1-[(2R)-3,4-bis[(3-nitrophenyl)methoxy]-5-oxo-2H-furan-2-yl]-2-hydroxyethyl] phosphate.
| Compound Name | dibenzyl [(1S)-1-[(2R)-3,4-bis[(3-nitrophenyl)methoxy]-5-oxo-2H-furan-2-yl]-2-hydroxyethyl] phosphate |
|---|---|
| PubChem CID | 71609408 |
| Molecular Formula | C34H31N2O13P |
| Molecular Weight | 706.60 g/mol |
| Exact Mass | 706.16 |
| IUPAC Name | dibenzyl [(1S)-1-[(2R)-3,4-bis[(3-nitrophenyl)methoxy]-5-oxo-2H-furan-2-yl]-2-hydroxyethyl] phosphate |
| SMILES | O=C1O[C@H]([C@H](CO)OP(=O)(OCc2ccccc2)OCc2ccccc2)C(OCc2cccc([N+](=O)[O-])c2)=C1OCc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C34H31N2O13P/c37-19-30(49-50(43,46-22-24-9-3-1-4-10-24)47-23-25-11-5-2-6-12-25)31-32(44-20-26-13-7-15-28(17-26)35(39)40)33(34(38)48-31)45-21-27-14-8-16-29(18-27)36(41)42/h1-18,30-31,37H,19-23H2/t30-,31+/m0/s1 |
| InChIKey | YVGKDNZZURAYTK-IOWSJCHKSA-N |
| XLogP | 6.29 |
| TPSA | 196.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.60 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|