C34H29F4O9P — CID 78056531
[1-[3,4-bis[(2-fluorophenyl)methoxy]-5-oxo-2H-furan-2-yl]-2-hydroxyethyl] bis[(2-fluorophenyl)methyl] phosphate (PubChem CID 78056531) has the molecular formula C34H29F4O9P and a molecular weight of 688.56 g/mol. Its IUPAC name is [1-[3,4-bis[(2-fluorophenyl)methoxy]-5-oxo-2H-furan-2-yl]-2-hydroxyethyl] bis[(2-fluorophenyl)methyl] phosphate.
| Compound Name | [1-[3,4-bis[(2-fluorophenyl)methoxy]-5-oxo-2H-furan-2-yl]-2-hydroxyethyl] bis[(2-fluorophenyl)methyl] phosphate |
|---|---|
| PubChem CID | 78056531 |
| Molecular Formula | C34H29F4O9P |
| Molecular Weight | 688.56 g/mol |
| Exact Mass | 688.15 |
| IUPAC Name | [1-[3,4-bis[(2-fluorophenyl)methoxy]-5-oxo-2H-furan-2-yl]-2-hydroxyethyl] bis[(2-fluorophenyl)methyl] phosphate |
| SMILES | O=C1OC(C(CO)OP(=O)(OCc2ccccc2F)OCc2ccccc2F)C(OCc2ccccc2F)=C1OCc1ccccc1F |
| InChI | InChI=1S/C34H29F4O9P/c35-26-13-5-1-9-22(26)18-42-32-31(46-34(40)33(32)43-19-23-10-2-6-14-27(23)36)30(17-39)47-48(41,44-20-24-11-3-7-15-28(24)37)45-21-25-12-4-8-16-29(25)38/h1-16,30-31,39H,17-21H2 |
| InChIKey | RHEZGQZUSLUNCH-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 109.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.56 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|