C34H29N4O9PS2 — CID 71262029
dibenzyl [(1S)-1-[(2R)-3,4-bis(2,1,3-benzothiadiazol-5-ylmethoxy)-5-oxo-2H-furan-2-yl]-2-hydroxyethyl] phosphate (PubChem CID 71262029) has the molecular formula C34H29N4O9PS2 and a molecular weight of 732.73 g/mol. Its IUPAC name is dibenzyl [(1S)-1-[(2R)-3,4-bis(2,1,3-benzothiadiazol-5-ylmethoxy)-5-oxo-2H-furan-2-yl]-2-hydroxyethyl] phosphate.
| Compound Name | dibenzyl [(1S)-1-[(2R)-3,4-bis(2,1,3-benzothiadiazol-5-ylmethoxy)-5-oxo-2H-furan-2-yl]-2-hydroxyethyl] phosphate |
|---|---|
| PubChem CID | 71262029 |
| Molecular Formula | C34H29N4O9PS2 |
| Molecular Weight | 732.73 g/mol |
| Exact Mass | 732.11 |
| IUPAC Name | dibenzyl [(1S)-1-[(2R)-3,4-bis(2,1,3-benzothiadiazol-5-ylmethoxy)-5-oxo-2H-furan-2-yl]-2-hydroxyethyl] phosphate |
| SMILES | O=C1O[C@H]([C@H](CO)OP(=O)(OCc2ccccc2)OCc2ccccc2)C(OCc2ccc3nsnc3c2)=C1OCc1ccc2nsnc2c1 |
| InChI | InChI=1S/C34H29N4O9PS2/c39-17-30(47-48(41,44-20-22-7-3-1-4-8-22)45-21-23-9-5-2-6-10-23)31-32(42-18-24-11-13-26-28(15-24)37-49-35-26)33(34(40)46-31)43-19-25-12-14-27-29(16-25)38-50-36-27/h1-16,30-31,39H,17-21H2/t30-,31+/m0/s1 |
| InChIKey | PTTDSYYUIPZZCF-IOWSJCHKSA-N |
| XLogP | 6.49 |
| TPSA | 161.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.73 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|