C38H41O13P — CID 78056552
[1-[3,4-bis[(2-methoxyphenyl)methoxy]-5-oxo-2H-furan-2-yl]-2-hydroxyethyl] bis[(2-methoxyphenyl)methyl] phosphate (PubChem CID 78056552) has the molecular formula C38H41O13P and a molecular weight of 736.71 g/mol. Its IUPAC name is [1-[3,4-bis[(2-methoxyphenyl)methoxy]-5-oxo-2H-furan-2-yl]-2-hydroxyethyl] bis[(2-methoxyphenyl)methyl] phosphate.
| Compound Name | [1-[3,4-bis[(2-methoxyphenyl)methoxy]-5-oxo-2H-furan-2-yl]-2-hydroxyethyl] bis[(2-methoxyphenyl)methyl] phosphate |
|---|---|
| PubChem CID | 78056552 |
| Molecular Formula | C38H41O13P |
| Molecular Weight | 736.71 g/mol |
| Exact Mass | 736.23 |
| IUPAC Name | [1-[3,4-bis[(2-methoxyphenyl)methoxy]-5-oxo-2H-furan-2-yl]-2-hydroxyethyl] bis[(2-methoxyphenyl)methyl] phosphate |
| SMILES | COc1ccccc1COC1=C(OCc2ccccc2OC)C(C(CO)OP(=O)(OCc2ccccc2OC)OCc2ccccc2OC)OC1=O |
| InChI | InChI=1S/C38H41O13P/c1-42-30-17-9-5-13-26(30)22-46-36-35(50-38(40)37(36)47-23-27-14-6-10-18-31(27)43-2)34(21-39)51-52(41,48-24-28-15-7-11-19-32(28)44-3)49-25-29-16-8-12-20-33(29)45-4/h5-20,34-35,39H,21-25H2,1-4H3 |
| InChIKey | MVYGOAKDSLNXRA-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 146.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 736.71 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|