C34H29Cl2F4O9P — CID 144525941
3,4-bis[(3-chloro-2,4-difluorophenyl)methoxy]-2-(2-hydroxyethyl)-2H-furan-5-one;dibenzyl hydrogen phosphate (PubChem CID 144525941) has the molecular formula C34H29Cl2F4O9P and a molecular weight of 759.47 g/mol. Its IUPAC name is 3,4-bis[(3-chloro-2,4-difluorophenyl)methoxy]-2-(2-hydroxyethyl)-2H-furan-5-one;dibenzyl hydrogen phosphate.
| Compound Name | 3,4-bis[(3-chloro-2,4-difluorophenyl)methoxy]-2-(2-hydroxyethyl)-2H-furan-5-one;dibenzyl hydrogen phosphate |
|---|---|
| PubChem CID | 144525941 |
| Molecular Formula | C34H29Cl2F4O9P |
| Molecular Weight | 759.47 g/mol |
| Exact Mass | 758.09 |
| IUPAC Name | 3,4-bis[(3-chloro-2,4-difluorophenyl)methoxy]-2-(2-hydroxyethyl)-2H-furan-5-one;dibenzyl hydrogen phosphate |
| SMILES | O=C1OC(CCO)C(OCc2ccc(F)c(Cl)c2F)=C1OCc1ccc(F)c(Cl)c1F.O=P(O)(OCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C20H14Cl2F4O5.C14H15O4P/c21-14-11(23)3-1-9(16(14)25)7-29-18-13(5-6-27)31-20(28)19(18)30-8-10-2-4-12(24)15(22)17(10)26;15-19(16,17-11-13-7-3-1-4-8-13)18-12-14-9-5-2-6-10-14/h1-4,13,27H,5-8H2;1-10H,11-12H2,(H,15,16) |
| InChIKey | ZRDXJSZRNZAVSA-UHFFFAOYSA-N |
| XLogP | 8.32 |
| TPSA | 120.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 759.47 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|