C13H14O5 — CID 54723596
3-hydroxy-2-(2-hydroxyethyl)-4-phenylmethoxy-2H-furan-5-one (PubChem CID 54723596) has the molecular formula C13H14O5 and a molecular weight of 250.25 g/mol. Its IUPAC name is 3-hydroxy-2-(2-hydroxyethyl)-4-phenylmethoxy-2H-furan-5-one.
| Compound Name | 3-hydroxy-2-(2-hydroxyethyl)-4-phenylmethoxy-2H-furan-5-one |
|---|---|
| PubChem CID | 54723596 |
| Molecular Formula | C13H14O5 |
| Molecular Weight | 250.25 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | 3-hydroxy-2-(2-hydroxyethyl)-4-phenylmethoxy-2H-furan-5-one |
| SMILES | O=C1OC(CCO)C(O)=C1OCc1ccccc1 |
| InChI | InChI=1S/C13H14O5/c14-7-6-10-11(15)12(13(16)18-10)17-8-9-4-2-1-3-5-9/h1-5,10,14-15H,6-8H2 |
| InChIKey | DTAQVOYIZWDIGD-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.25 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |