C20H18O5 — CID 10640735
(2R)-2-[(2S)-oxiran-2-yl]-3,4-bis(phenylmethoxy)-2H-furan-5-one (PubChem CID 10640735) has the molecular formula C20H18O5 and a molecular weight of 338.36 g/mol. Its IUPAC name is (2R)-2-[(2S)-oxiran-2-yl]-3,4-bis(phenylmethoxy)-2H-furan-5-one.
| Compound Name | (2R)-2-[(2S)-oxiran-2-yl]-3,4-bis(phenylmethoxy)-2H-furan-5-one |
|---|---|
| PubChem CID | 10640735 |
| Molecular Formula | C20H18O5 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | (2R)-2-[(2S)-oxiran-2-yl]-3,4-bis(phenylmethoxy)-2H-furan-5-one |
| SMILES | O=C1O[C@H]([C@@H]2CO2)C(OCc2ccccc2)=C1OCc1ccccc1 |
| InChI | InChI=1S/C20H18O5/c21-20-19(24-12-15-9-5-2-6-10-15)18(17(25-20)16-13-22-16)23-11-14-7-3-1-4-8-14/h1-10,16-17H,11-13H2/t16-,17+/m0/s1 |
| InChIKey | GWEOAIVNJJEWCX-DLBZAZTESA-N |
| XLogP | 2.96 |
| TPSA | 57.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|