C15H17NO3 — CID 67831100
3-(2-hydroxyethyl)-6-methyl-5-phenylmethoxy-3H-pyridin-4-one (PubChem CID 67831100) has the molecular formula C15H17NO3 and a molecular weight of 259.30 g/mol. Its IUPAC name is 3-(2-hydroxyethyl)-6-methyl-5-phenylmethoxy-3H-pyridin-4-one.
| Compound Name | 3-(2-hydroxyethyl)-6-methyl-5-phenylmethoxy-3H-pyridin-4-one |
|---|---|
| PubChem CID | 67831100 |
| Molecular Formula | C15H17NO3 |
| Molecular Weight | 259.30 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | 3-(2-hydroxyethyl)-6-methyl-5-phenylmethoxy-3H-pyridin-4-one |
| SMILES | CC1=C(OCc2ccccc2)C(=O)C(CCO)C=N1 |
| InChI | InChI=1S/C15H17NO3/c1-11-15(14(18)13(7-8-17)9-16-11)19-10-12-5-3-2-4-6-12/h2-6,9,13,17H,7-8,10H2,1H3 |
| InChIKey | CCWJGDAHOFUELP-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.30 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |