C14H15NO6 — CID 132819673
3-O-benzyl 4-O-ethyl (1S,4S,5R)-2,6-dioxa-3-azabicyclo[3.1.0]hexane-3,4-dicarboxylate (PubChem CID 132819673) has the molecular formula C14H15NO6 and a molecular weight of 293.27 g/mol. Its IUPAC name is 3-O-benzyl 4-O-ethyl (1S,4S,5R)-2,6-dioxa-3-azabicyclo[3.1.0]hexane-3,4-dicarboxylate.
| Compound Name | 3-O-benzyl 4-O-ethyl (1S,4S,5R)-2,6-dioxa-3-azabicyclo[3.1.0]hexane-3,4-dicarboxylate |
|---|---|
| PubChem CID | 132819673 |
| Molecular Formula | C14H15NO6 |
| Molecular Weight | 293.27 g/mol |
| Exact Mass | 293.09 |
| IUPAC Name | 3-O-benzyl 4-O-ethyl (1S,4S,5R)-2,6-dioxa-3-azabicyclo[3.1.0]hexane-3,4-dicarboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@H]2O[C@H]2ON1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C14H15NO6/c1-2-18-12(16)10-11-13(20-11)21-15(10)14(17)19-8-9-6-4-3-5-7-9/h3-7,10-11,13H,2,8H2,1H3/t10-,11+,13-/m0/s1 |
| InChIKey | ZNSZZLXVVRDHGX-LOWVWBTDSA-N |
| XLogP | 1.23 |
| TPSA | 77.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.27 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|