C20H20N2O6 — CID 101166780
methyl (4S,5R)-4-benzyl-2-oxo-3-(phenylmethoxycarbonylamino)-1,3-oxazolidine-5-carboxylate (PubChem CID 101166780) has the molecular formula C20H20N2O6 and a molecular weight of 384.39 g/mol. Its IUPAC name is methyl (4S,5R)-4-benzyl-2-oxo-3-(phenylmethoxycarbonylamino)-1,3-oxazolidine-5-carboxylate.
| Compound Name | methyl (4S,5R)-4-benzyl-2-oxo-3-(phenylmethoxycarbonylamino)-1,3-oxazolidine-5-carboxylate |
|---|---|
| PubChem CID | 101166780 |
| Molecular Formula | C20H20N2O6 |
| Molecular Weight | 384.39 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | methyl (4S,5R)-4-benzyl-2-oxo-3-(phenylmethoxycarbonylamino)-1,3-oxazolidine-5-carboxylate |
| SMILES | COC(=O)[C@@H]1OC(=O)N(NC(=O)OCc2ccccc2)[C@H]1Cc1ccccc1 |
| InChI | InChI=1S/C20H20N2O6/c1-26-18(23)17-16(12-14-8-4-2-5-9-14)22(20(25)28-17)21-19(24)27-13-15-10-6-3-7-11-15/h2-11,16-17H,12-13H2,1H3,(H,21,24)/t16-,17+/m0/s1 |
| InChIKey | XKBWOORSJREHFQ-DLBZAZTESA-N |
| XLogP | 2.43 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.39 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|