benzyl 4-(5-decylpyrimidin-2-yl)oxolane-2-carboxylate

C26H36N2O3 — CID 67893481

IUPACbenzyl 4-(5-decylpyrimidin-2-yl)oxolane-2-carboxylate
SMILESCCCCCCCCCCc1cnc(C2COC(C(=O)OCc3ccccc3)C2)nc1
InChIInChI=1S/C26H36N2O3/c1-2-3-4-5-6-7-8-10-15-22-17-27-25(28-18-22)23-16-24(30-20-23)26(29)31-19-21-13-11-9-12-14-21/h9,11-14,17-18,23-24H,2-8,10,15-16,19-20H2,1H3
InChIKeyDSKVBMCCWXCCFR-UHFFFAOYSA-N
MW424.59 g/mol
LogP5.78
Rot. Bonds13

About benzyl 4-(5-decylpyrimidin-2-yl)oxolane-2-carboxylate

benzyl 4-(5-decylpyrimidin-2-yl)oxolane-2-carboxylate (PubChem CID 67893481) has the molecular formula C26H36N2O3 and a molecular weight of 424.59 g/mol. Its IUPAC name is benzyl 4-(5-decylpyrimidin-2-yl)oxolane-2-carboxylate.

Molecular Properties

Compound Namebenzyl 4-(5-decylpyrimidin-2-yl)oxolane-2-carboxylate
PubChem CID67893481
Molecular FormulaC26H36N2O3
Molecular Weight424.59 g/mol
Exact Mass424.27
IUPAC Namebenzyl 4-(5-decylpyrimidin-2-yl)oxolane-2-carboxylate
SMILESCCCCCCCCCCc1cnc(C2COC(C(=O)OCc3ccccc3)C2)nc1
InChIInChI=1S/C26H36N2O3/c1-2-3-4-5-6-7-8-10-15-22-17-27-25(28-18-22)23-16-24(30-20-23)26(29)31-19-21-13-11-9-12-14-21/h9,11-14,17-18,23-24H,2-8,10,15-16,19-20H2,1H3
InChIKeyDSKVBMCCWXCCFR-UHFFFAOYSA-N
XLogP5.78
TPSA61.31 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds13
Heavy Atoms31
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500424.59
LogP ≤ 55.78
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze benzyl 4-(5-decylpyrimidin-2-yl)oxolane-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of benzyl 4-(5-decylpyrimidin-2-yl)oxolane-2-carboxylate?
The IUPAC name of benzyl 4-(5-decylpyrimidin-2-yl)oxolane-2-carboxylate (CID 67893481) is benzyl 4-(5-decylpyrimidin-2-yl)oxolane-2-carboxylate.
What is the SMILES notation for benzyl 4-(5-decylpyrimidin-2-yl)oxolane-2-carboxylate?
The canonical SMILES for benzyl 4-(5-decylpyrimidin-2-yl)oxolane-2-carboxylate is CCCCCCCCCCc1cnc(C2COC(C(=O)OCc3ccccc3)C2)nc1.
What is the InChIKey of benzyl 4-(5-decylpyrimidin-2-yl)oxolane-2-carboxylate?
The InChIKey is DSKVBMCCWXCCFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H36N2O3/c1-2-3-4-5-6-7-8-10-15-22-17-27-25(28-18-22)23-16-24(30-20-23)26(29)31-19-21-13-11-9-12-14-21/h9,11-14,17-18,23-24H,2-8,10,15-16,19-20H2,1H3.
What are the key properties of benzyl 4-(5-decylpyrimidin-2-yl)oxolane-2-carboxylate?
benzyl 4-(5-decylpyrimidin-2-yl)oxolane-2-carboxylate has a molecular weight of 424.59 g/mol, XLogP of 5.78, 13 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 4-(5-decylpyrimidin-2-yl)oxolane-2-carboxylate is sourced from PubChem (CID 67893481), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).