C26H36N2O3 — CID 67893481
benzyl 4-(5-decylpyrimidin-2-yl)oxolane-2-carboxylate (PubChem CID 67893481) has the molecular formula C26H36N2O3 and a molecular weight of 424.59 g/mol. Its IUPAC name is benzyl 4-(5-decylpyrimidin-2-yl)oxolane-2-carboxylate.
| Compound Name | benzyl 4-(5-decylpyrimidin-2-yl)oxolane-2-carboxylate |
|---|---|
| PubChem CID | 67893481 |
| Molecular Formula | C26H36N2O3 |
| Molecular Weight | 424.59 g/mol |
| Exact Mass | 424.27 |
| IUPAC Name | benzyl 4-(5-decylpyrimidin-2-yl)oxolane-2-carboxylate |
| SMILES | CCCCCCCCCCc1cnc(C2COC(C(=O)OCc3ccccc3)C2)nc1 |
| InChI | InChI=1S/C26H36N2O3/c1-2-3-4-5-6-7-8-10-15-22-17-27-25(28-18-22)23-16-24(30-20-23)26(29)31-19-21-13-11-9-12-14-21/h9,11-14,17-18,23-24H,2-8,10,15-16,19-20H2,1H3 |
| InChIKey | DSKVBMCCWXCCFR-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.59 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|