C12H16N2O3 — CID 139232497
ethyl (3R,5R)-3-amino-2-phenyl-1,2-oxazolidine-5-carboxylate (PubChem CID 139232497) has the molecular formula C12H16N2O3 and a molecular weight of 236.27 g/mol. Its IUPAC name is ethyl (3R,5R)-3-amino-2-phenyl-1,2-oxazolidine-5-carboxylate.
| Compound Name | ethyl (3R,5R)-3-amino-2-phenyl-1,2-oxazolidine-5-carboxylate |
|---|---|
| PubChem CID | 139232497 |
| Molecular Formula | C12H16N2O3 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | ethyl (3R,5R)-3-amino-2-phenyl-1,2-oxazolidine-5-carboxylate |
| SMILES | CCOC(=O)[C@H]1C[C@H](N)N(c2ccccc2)O1 |
| InChI | InChI=1S/C12H16N2O3/c1-2-16-12(15)10-8-11(13)14(17-10)9-6-4-3-5-7-9/h3-7,10-11H,2,8,13H2,1H3/t10-,11-/m1/s1 |
| InChIKey | OHAUDPIKIMQKDU-GHMZBOCLSA-N |
| XLogP | 1.04 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |