C17H21NO3 — CID 102515997
ethyl (1S,2R,7S,8R,9R)-3-oxa-10-azatetracyclo[7.7.0.02,7.011,16]hexadeca-11,13,15-triene-8-carboxylate (PubChem CID 102515997) has the molecular formula C17H21NO3 and a molecular weight of 287.36 g/mol. Its IUPAC name is ethyl (1S,2R,7S,8R,9R)-3-oxa-10-azatetracyclo[7.7.0.02,7.011,16]hexadeca-11,13,15-triene-8-carboxylate.
| Compound Name | ethyl (1S,2R,7S,8R,9R)-3-oxa-10-azatetracyclo[7.7.0.02,7.011,16]hexadeca-11,13,15-triene-8-carboxylate |
|---|---|
| PubChem CID | 102515997 |
| Molecular Formula | C17H21NO3 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | ethyl (1S,2R,7S,8R,9R)-3-oxa-10-azatetracyclo[7.7.0.02,7.011,16]hexadeca-11,13,15-triene-8-carboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@@H]2CCCO[C@H]2[C@H]2c3ccccc3N[C@@H]12 |
| InChI | InChI=1S/C17H21NO3/c1-2-20-17(19)14-11-7-5-9-21-16(11)13-10-6-3-4-8-12(10)18-15(13)14/h3-4,6,8,11,13-16,18H,2,5,7,9H2,1H3/t11-,13-,14+,15+,16+/m0/s1 |
| InChIKey | UOHLHSRCHJSHFG-RBRCJPGISA-N |
| XLogP | 2.55 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |