About 2-diethoxyphosphorylacetonitrile;2-(4-phenylcyclohexyl)acetonitrile
2-diethoxyphosphorylacetonitrile;2-(4-phenylcyclohexyl)acetonitrile (PubChem CID 159753870) has the molecular formula C20H29N2O3P
and a molecular weight of 376.44 g/mol. Its IUPAC name is 2-diethoxyphosphorylacetonitrile;2-(4-phenylcyclohexyl)acetonitrile.
Molecular Properties
| Compound Name | 2-diethoxyphosphorylacetonitrile;2-(4-phenylcyclohexyl)acetonitrile |
| PubChem CID | 159753870 |
| Molecular Formula | C20H29N2O3P |
| Molecular Weight | 376.44 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | 2-diethoxyphosphorylacetonitrile;2-(4-phenylcyclohexyl)acetonitrile |
| SMILES | CCOP(=O)(CC#N)OCC.N#CCC1CCC(c2ccccc2)CC1 |
| InChI | InChI=1S/C14H17N.C6H12NO3P/c15-11-10-12-6-8-14(9-7-12)13-4-2-1-3-5-13;1-3-9-11(8,6-5-7)10-4-2/h1-5,12,14H,6-10H2;3-4,6H2,1-2H3 |
| InChIKey | NDZPZSKCDOQZJS-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 83.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 376.44 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-diethoxyphosphorylacetonitrile;2-(4-phenylcyclohexyl)acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-diethoxyphosphorylacetonitrile;2-(4-phenylcyclohexyl)acetonitrile?
The IUPAC name of 2-diethoxyphosphorylacetonitrile;2-(4-phenylcyclohexyl)acetonitrile (CID 159753870) is 2-diethoxyphosphorylacetonitrile;2-(4-phenylcyclohexyl)acetonitrile.
What is the SMILES notation for 2-diethoxyphosphorylacetonitrile;2-(4-phenylcyclohexyl)acetonitrile?
The canonical SMILES for 2-diethoxyphosphorylacetonitrile;2-(4-phenylcyclohexyl)acetonitrile is CCOP(=O)(CC#N)OCC.N#CCC1CCC(c2ccccc2)CC1.
What is the InChIKey of 2-diethoxyphosphorylacetonitrile;2-(4-phenylcyclohexyl)acetonitrile?
The InChIKey is NDZPZSKCDOQZJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17N.C6H12NO3P/c15-11-10-12-6-8-14(9-7-12)13-4-2-1-3-5-13;1-3-9-11(8,6-5-7)10-4-2/h1-5,12,14H,6-10H2;3-4,6H2,1-2H3.
What are the key properties of 2-diethoxyphosphorylacetonitrile;2-(4-phenylcyclohexyl)acetonitrile?
2-diethoxyphosphorylacetonitrile;2-(4-phenylcyclohexyl)acetonitrile has a molecular weight of 376.44 g/mol, XLogP of 5.65, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-diethoxyphosphorylacetonitrile;2-(4-phenylcyclohexyl)acetonitrile is sourced from PubChem (CID 159753870), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).