C15H25N2O7P — CID 11068827
1-[(2R,4S,5S)-4-(diethoxyphosphorylmethyl)-5-(hydroxymethyl)oxolan-2-yl]-4-methoxypyrimidin-2-one (PubChem CID 11068827) has the molecular formula C15H25N2O7P and a molecular weight of 376.35 g/mol. Its IUPAC name is 1-[(2R,4S,5S)-4-(diethoxyphosphorylmethyl)-5-(hydroxymethyl)oxolan-2-yl]-4-methoxypyrimidin-2-one.
| Compound Name | 1-[(2R,4S,5S)-4-(diethoxyphosphorylmethyl)-5-(hydroxymethyl)oxolan-2-yl]-4-methoxypyrimidin-2-one |
|---|---|
| PubChem CID | 11068827 |
| Molecular Formula | C15H25N2O7P |
| Molecular Weight | 376.35 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | 1-[(2R,4S,5S)-4-(diethoxyphosphorylmethyl)-5-(hydroxymethyl)oxolan-2-yl]-4-methoxypyrimidin-2-one |
| SMILES | CCOP(=O)(C[C@H]1C[C@H](n2ccc(OC)nc2=O)O[C@@H]1CO)OCC |
| InChI | InChI=1S/C15H25N2O7P/c1-4-22-25(20,23-5-2)10-11-8-14(24-12(11)9-18)17-7-6-13(21-3)16-15(17)19/h6-7,11-12,14,18H,4-5,8-10H2,1-3H3/t11-,12-,14-/m1/s1 |
| InChIKey | HBPVGSOZMYSXQC-YRGRVCCFSA-N |
| XLogP | 1.41 |
| TPSA | 109.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.35 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|