C10H15N6O6P — CID 22841936
[(2S,3R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3-(azidomethyl)oxolan-2-yl]methyl dihydrogen phosphate (PubChem CID 22841936) has the molecular formula C10H15N6O6P and a molecular weight of 346.24 g/mol. Its IUPAC name is [(2S,3R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3-(azidomethyl)oxolan-2-yl]methyl dihydrogen phosphate.
| Compound Name | [(2S,3R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3-(azidomethyl)oxolan-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 22841936 |
| Molecular Formula | C10H15N6O6P |
| Molecular Weight | 346.24 g/mol |
| Exact Mass | 346.08 |
| IUPAC Name | [(2S,3R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3-(azidomethyl)oxolan-2-yl]methyl dihydrogen phosphate |
| SMILES | [N-]=[N+]=NC[C@H]1C[C@H](n2ccc(N)nc2=O)O[C@@H]1COP(=O)(O)O |
| InChI | InChI=1S/C10H15N6O6P/c11-8-1-2-16(10(17)14-8)9-3-6(4-13-15-12)7(22-9)5-21-23(18,19)20/h1-2,6-7,9H,3-5H2,(H2,11,14,17)(H2,18,19,20)/t6-,7-,9-/m1/s1 |
| InChIKey | GHGUYGJKSOVFLF-ZXFLCMHBSA-N |
| XLogP | 0.15 |
| TPSA | 185.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.24 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|