C31H66O6SSi3 — CID 135022559
[(4R,6R)-3-[(2S,5S,6S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methyloxan-2-yl]sulfanyl-6-methoxy-2-methyloxan-4-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 135022559) has the molecular formula C31H66O6SSi3 and a molecular weight of 651.19 g/mol. Its IUPAC name is [(4R,6R)-3-[(2S,5S,6S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methyloxan-2-yl]sulfanyl-6-methoxy-2-methyloxan-4-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(4R,6R)-3-[(2S,5S,6S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methyloxan-2-yl]sulfanyl-6-methoxy-2-methyloxan-4-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 135022559 |
| Molecular Formula | C31H66O6SSi3 |
| Molecular Weight | 651.19 g/mol |
| Exact Mass | 650.39 |
| IUPAC Name | [(4R,6R)-3-[(2S,5S,6S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methyloxan-2-yl]sulfanyl-6-methoxy-2-methyloxan-4-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | CO[C@H]1C[C@@H](O[Si](C)(C)C(C)(C)C)C(S[C@H]2CC(O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C)O2)C(C)O1 |
| InChI | InChI=1S/C31H66O6SSi3/c1-21-27(37-41(17,18)31(9,10)11)23(35-39(13,14)29(3,4)5)20-26(34-21)38-28-22(2)33-25(32-12)19-24(28)36-40(15,16)30(6,7)8/h21-28H,19-20H2,1-18H3/t21-,22?,23?,24+,25+,26-,27-,28?/m0/s1 |
| InChIKey | NVLKXLWRPLGFFU-NOKLSPLLSA-N |
| XLogP | 9.18 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.19 |
| LogP ≤ 5 | 9.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|