C26H45NO5Si2 — CID 139247736
4-[(2R,4R,5R,6R)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methyloxan-2-yl]-2-hydroxy-5-methoxybenzonitrile (PubChem CID 139247736) has the molecular formula C26H45NO5Si2 and a molecular weight of 507.82 g/mol. Its IUPAC name is 4-[(2R,4R,5R,6R)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methyloxan-2-yl]-2-hydroxy-5-methoxybenzonitrile.
| Compound Name | 4-[(2R,4R,5R,6R)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methyloxan-2-yl]-2-hydroxy-5-methoxybenzonitrile |
|---|---|
| PubChem CID | 139247736 |
| Molecular Formula | C26H45NO5Si2 |
| Molecular Weight | 507.82 g/mol |
| Exact Mass | 507.28 |
| IUPAC Name | 4-[(2R,4R,5R,6R)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methyloxan-2-yl]-2-hydroxy-5-methoxybenzonitrile |
| SMILES | COc1cc(C#N)c(O)cc1[C@H]1C[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)O1 |
| InChI | InChI=1S/C26H45NO5Si2/c1-17-24(32-34(11,12)26(5,6)7)23(31-33(9,10)25(2,3)4)15-22(30-17)19-14-20(28)18(16-27)13-21(19)29-8/h13-14,17,22-24,28H,15H2,1-12H3/t17-,22-,23-,24-/m1/s1 |
| InChIKey | ATDLDGZEXBJUPH-SFUZCSOBSA-N |
| XLogP | 6.90 |
| TPSA | 80.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.82 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|