C22H38BFN2O4Si — CID 156771683
2-amino-N-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-6-fluoro-N-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide (PubChem CID 156771683) has the molecular formula C22H38BFN2O4Si and a molecular weight of 452.45 g/mol. Its IUPAC name is 2-amino-N-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-6-fluoro-N-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide.
| Compound Name | 2-amino-N-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-6-fluoro-N-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide |
|---|---|
| PubChem CID | 156771683 |
| Molecular Formula | C22H38BFN2O4Si |
| Molecular Weight | 452.45 g/mol |
| Exact Mass | 452.27 |
| IUPAC Name | 2-amino-N-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-6-fluoro-N-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide |
| SMILES | CN(CCO[Si](C)(C)C(C)(C)C)C(=O)c1c(N)cc(B2OC(C)(C)C(C)(C)O2)cc1F |
| InChI | InChI=1S/C22H38BFN2O4Si/c1-20(2,3)31(9,10)28-12-11-26(8)19(27)18-16(24)13-15(14-17(18)25)23-29-21(4,5)22(6,7)30-23/h13-14H,11-12,25H2,1-10H3 |
| InChIKey | MTAWXUXMOYULHS-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 74.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.45 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|