C22H37BFNO4Si — CID 175824063
2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-6-fluoro-N-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide (PubChem CID 175824063) has the molecular formula C22H37BFNO4Si and a molecular weight of 437.44 g/mol. Its IUPAC name is 2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-6-fluoro-N-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide.
| Compound Name | 2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-6-fluoro-N-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide |
|---|---|
| PubChem CID | 175824063 |
| Molecular Formula | C22H37BFNO4Si |
| Molecular Weight | 437.44 g/mol |
| Exact Mass | 437.26 |
| IUPAC Name | 2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-6-fluoro-N-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide |
| SMILES | CNC(=O)c1c(F)cc(B2OC(C)(C)C(C)(C)O2)cc1CCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H37BFNO4Si/c1-20(2,3)30(9,10)27-12-11-15-13-16(14-17(24)18(15)19(26)25-8)23-28-21(4,5)22(6,7)29-23/h13-14H,11-12H2,1-10H3,(H,25,26) |
| InChIKey | OZZYITUVNCVTEC-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.44 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|