C17H23BFNO4 — CID 166009677
N-cyclopropyl-2-fluoro-6-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide (PubChem CID 166009677) has the molecular formula C17H23BFNO4 and a molecular weight of 335.18 g/mol. Its IUPAC name is N-cyclopropyl-2-fluoro-6-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide.
| Compound Name | N-cyclopropyl-2-fluoro-6-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide |
|---|---|
| PubChem CID | 166009677 |
| Molecular Formula | C17H23BFNO4 |
| Molecular Weight | 335.18 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | N-cyclopropyl-2-fluoro-6-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide |
| SMILES | COc1cc(B2OC(C)(C)C(C)(C)O2)cc(F)c1C(=O)NC1CC1 |
| InChI | InChI=1S/C17H23BFNO4/c1-16(2)17(3,4)24-18(23-16)10-8-12(19)14(13(9-10)22-5)15(21)20-11-6-7-11/h8-9,11H,6-7H2,1-5H3,(H,20,21) |
| InChIKey | TVFQKZORMKVXCQ-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.18 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|