C19H24BF3O5 — CID 167619985
1-[2-(difluoromethoxy)-6-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2-[(1R,2S)-2-fluorocyclopropyl]ethanone (PubChem CID 167619985) has the molecular formula C19H24BF3O5 and a molecular weight of 400.20 g/mol. Its IUPAC name is 1-[2-(difluoromethoxy)-6-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2-[(1R,2S)-2-fluorocyclopropyl]ethanone.
| Compound Name | 1-[2-(difluoromethoxy)-6-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2-[(1R,2S)-2-fluorocyclopropyl]ethanone |
|---|---|
| PubChem CID | 167619985 |
| Molecular Formula | C19H24BF3O5 |
| Molecular Weight | 400.20 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | 1-[2-(difluoromethoxy)-6-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2-[(1R,2S)-2-fluorocyclopropyl]ethanone |
| SMILES | COc1cc(B2OC(C)(C)C(C)(C)O2)cc(OC(F)F)c1C(=O)C[C@@H]1C[C@@H]1F |
| InChI | InChI=1S/C19H24BF3O5/c1-18(2)19(3,4)28-20(27-18)11-8-14(25-5)16(15(9-11)26-17(22)23)13(24)7-10-6-12(10)21/h8-10,12,17H,6-7H2,1-5H3/t10-,12-/m0/s1 |
| InChIKey | MHLYQTYMEQKJAM-JQWIXIFHSA-N |
| XLogP | 3.53 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.20 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|