C17H26FNO3Si — CID 145207291
4-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-fluoro-2-hydroxy-3-(1-hydroxypropan-2-yl)benzonitrile (PubChem CID 145207291) has the molecular formula C17H26FNO3Si and a molecular weight of 339.48 g/mol. Its IUPAC name is 4-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-fluoro-2-hydroxy-3-(1-hydroxypropan-2-yl)benzonitrile.
| Compound Name | 4-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-fluoro-2-hydroxy-3-(1-hydroxypropan-2-yl)benzonitrile |
|---|---|
| PubChem CID | 145207291 |
| Molecular Formula | C17H26FNO3Si |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | 4-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-fluoro-2-hydroxy-3-(1-hydroxypropan-2-yl)benzonitrile |
| SMILES | CC(CO)c1c(CO[Si](C)(C)C(C)(C)C)cc(F)c(C#N)c1O |
| InChI | InChI=1S/C17H26FNO3Si/c1-11(9-20)15-12(7-14(18)13(8-19)16(15)21)10-22-23(5,6)17(2,3)4/h7,11,20-21H,9-10H2,1-6H3 |
| InChIKey | WRYIDTGVGMDICD-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 73.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|