C13H16F3NOSi — CID 91735452
4-[dimethyl-[(2,4,5-trifluorophenyl)methoxy]silyl]butanenitrile (PubChem CID 91735452) has the molecular formula C13H16F3NOSi and a molecular weight of 287.36 g/mol. Its IUPAC name is 4-[dimethyl-[(2,4,5-trifluorophenyl)methoxy]silyl]butanenitrile.
| Compound Name | 4-[dimethyl-[(2,4,5-trifluorophenyl)methoxy]silyl]butanenitrile |
|---|---|
| PubChem CID | 91735452 |
| Molecular Formula | C13H16F3NOSi |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | 4-[dimethyl-[(2,4,5-trifluorophenyl)methoxy]silyl]butanenitrile |
| SMILES | C[Si](C)(CCCC#N)OCc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C13H16F3NOSi/c1-19(2,6-4-3-5-17)18-9-10-7-12(15)13(16)8-11(10)14/h7-8H,3-4,6,9H2,1-2H3 |
| InChIKey | PDBMKWQYIHNALD-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|