C12H15Cl2NOSi — CID 532667
4-[(3,4-dichlorophenoxy)-dimethylsilyl]butanenitrile (PubChem CID 532667) has the molecular formula C12H15Cl2NOSi and a molecular weight of 288.25 g/mol. Its IUPAC name is 4-[(3,4-dichlorophenoxy)-dimethylsilyl]butanenitrile.
| Compound Name | 4-[(3,4-dichlorophenoxy)-dimethylsilyl]butanenitrile |
|---|---|
| PubChem CID | 532667 |
| Molecular Formula | C12H15Cl2NOSi |
| Molecular Weight | 288.25 g/mol |
| Exact Mass | 287.03 |
| IUPAC Name | 4-[(3,4-dichlorophenoxy)-dimethylsilyl]butanenitrile |
| SMILES | C[Si](C)(CCCC#N)Oc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C12H15Cl2NOSi/c1-17(2,8-4-3-7-15)16-10-5-6-11(13)12(14)9-10/h5-6,9H,3-4,8H2,1-2H3 |
| InChIKey | FENOGVQYXXZVEH-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.25 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|