C15H10F8OSi — CID 91719186
dimethyl-(2,3,4,5,6-pentafluorophenyl)-[(2,4,5-trifluorophenyl)methoxy]silane (PubChem CID 91719186) has the molecular formula C15H10F8OSi and a molecular weight of 386.31 g/mol. Its IUPAC name is dimethyl-(2,3,4,5,6-pentafluorophenyl)-[(2,4,5-trifluorophenyl)methoxy]silane.
| Compound Name | dimethyl-(2,3,4,5,6-pentafluorophenyl)-[(2,4,5-trifluorophenyl)methoxy]silane |
|---|---|
| PubChem CID | 91719186 |
| Molecular Formula | C15H10F8OSi |
| Molecular Weight | 386.31 g/mol |
| Exact Mass | 386.04 |
| IUPAC Name | dimethyl-(2,3,4,5,6-pentafluorophenyl)-[(2,4,5-trifluorophenyl)methoxy]silane |
| SMILES | C[Si](C)(OCc1cc(F)c(F)cc1F)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C15H10F8OSi/c1-25(2,15-13(22)11(20)10(19)12(21)14(15)23)24-5-6-3-8(17)9(18)4-7(6)16/h3-4H,5H2,1-2H3 |
| InChIKey | XNFOYOSONCAIFD-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.31 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|