C17H34O2Si — CID 22164928
9-[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxynon-4-yn-1-ol (PubChem CID 22164928) has the molecular formula C17H34O2Si and a molecular weight of 298.54 g/mol. Its IUPAC name is 9-[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxynon-4-yn-1-ol.
| Compound Name | 9-[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxynon-4-yn-1-ol |
|---|---|
| PubChem CID | 22164928 |
| Molecular Formula | C17H34O2Si |
| Molecular Weight | 298.54 g/mol |
| Exact Mass | 298.23 |
| IUPAC Name | 9-[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxynon-4-yn-1-ol |
| SMILES | CC(C)C(C)(C)[Si](C)(C)OCCCCC#CCCCO |
| InChI | InChI=1S/C17H34O2Si/c1-16(2)17(3,4)20(5,6)19-15-13-11-9-7-8-10-12-14-18/h16,18H,9-15H2,1-6H3 |
| InChIKey | GVUQZJLMHLOPPK-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.54 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|