C18H36O4Si — CID 11727654
(7R)-7-[[tert-butyl(dimethyl)silyl]oxymethyl]-8-(methoxymethoxy)-7-methyloct-2-yn-1-ol (PubChem CID 11727654) has the molecular formula C18H36O4Si and a molecular weight of 344.57 g/mol. Its IUPAC name is (7R)-7-[[tert-butyl(dimethyl)silyl]oxymethyl]-8-(methoxymethoxy)-7-methyloct-2-yn-1-ol.
| Compound Name | (7R)-7-[[tert-butyl(dimethyl)silyl]oxymethyl]-8-(methoxymethoxy)-7-methyloct-2-yn-1-ol |
|---|---|
| PubChem CID | 11727654 |
| Molecular Formula | C18H36O4Si |
| Molecular Weight | 344.57 g/mol |
| Exact Mass | 344.24 |
| IUPAC Name | (7R)-7-[[tert-butyl(dimethyl)silyl]oxymethyl]-8-(methoxymethoxy)-7-methyloct-2-yn-1-ol |
| SMILES | COCOC[C@@](C)(CCCC#CCO)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H36O4Si/c1-17(2,3)23(6,7)22-15-18(4,14-21-16-20-5)12-10-8-9-11-13-19/h19H,8,10,12-16H2,1-7H3/t18-/m1/s1 |
| InChIKey | KLIDFJWYDBPDBB-GOSISDBHSA-N |
| XLogP | 3.80 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.57 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|