C10H18I2O — CID 15311190
(2S,3R)-1,3-diiodo-3,7-dimethyloct-6-en-2-ol (PubChem CID 15311190) has the molecular formula C10H18I2O and a molecular weight of 408.06 g/mol. Its IUPAC name is (2S,3R)-1,3-diiodo-3,7-dimethyloct-6-en-2-ol.
| Compound Name | (2S,3R)-1,3-diiodo-3,7-dimethyloct-6-en-2-ol |
|---|---|
| PubChem CID | 15311190 |
| Molecular Formula | C10H18I2O |
| Molecular Weight | 408.06 g/mol |
| Exact Mass | 407.94 |
| IUPAC Name | (2S,3R)-1,3-diiodo-3,7-dimethyloct-6-en-2-ol |
| SMILES | CC(C)=CCC[C@@](C)(I)[C@@H](O)CI |
| InChI | InChI=1S/C10H18I2O/c1-8(2)5-4-6-10(3,12)9(13)7-11/h5,9,13H,4,6-7H2,1-3H3/t9-,10+/m0/s1 |
| InChIKey | UGBJNFWVVRBOBB-VHSXEESVSA-N |
| XLogP | 3.72 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.06 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|