C14H23IO — CID 10991240
(3Z)-3-iodo-2,6,10-trimethylundeca-1,3,9-trien-6-ol (PubChem CID 10991240) has the molecular formula C14H23IO and a molecular weight of 334.24 g/mol. Its IUPAC name is (3Z)-3-iodo-2,6,10-trimethylundeca-1,3,9-trien-6-ol.
| Compound Name | (3Z)-3-iodo-2,6,10-trimethylundeca-1,3,9-trien-6-ol |
|---|---|
| PubChem CID | 10991240 |
| Molecular Formula | C14H23IO |
| Molecular Weight | 334.24 g/mol |
| Exact Mass | 334.08 |
| IUPAC Name | (3Z)-3-iodo-2,6,10-trimethylundeca-1,3,9-trien-6-ol |
| SMILES | C=C(C)/C(I)=C/CC(C)(O)CCC=C(C)C |
| InChI | InChI=1S/C14H23IO/c1-11(2)7-6-9-14(5,16)10-8-13(15)12(3)4/h7-8,16H,3,6,9-10H2,1-2,4-5H3/b13-8- |
| InChIKey | SFJPHODESULUPR-JYRVWZFOSA-N |
| XLogP | 4.77 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.24 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|