C14H23N — CID 89309961
2,6-dimethyl-2-(3-methylbut-2-enyl)hept-5-enenitrile (PubChem CID 89309961) has the molecular formula C14H23N and a molecular weight of 205.34 g/mol. Its IUPAC name is 2,6-dimethyl-2-(3-methylbut-2-enyl)hept-5-enenitrile.
| Compound Name | 2,6-dimethyl-2-(3-methylbut-2-enyl)hept-5-enenitrile |
|---|---|
| PubChem CID | 89309961 |
| Molecular Formula | C14H23N |
| Molecular Weight | 205.34 g/mol |
| Exact Mass | 205.18 |
| IUPAC Name | 2,6-dimethyl-2-(3-methylbut-2-enyl)hept-5-enenitrile |
| SMILES | CC(C)=CCCC(C)(C#N)CC=C(C)C |
| InChI | InChI=1S/C14H23N/c1-12(2)7-6-9-14(5,11-15)10-8-13(3)4/h7-8H,6,9-10H2,1-5H3 |
| InChIKey | GZFWFZCUNCLXEG-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.34 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|