C15H26N2 — CID 23266621
2-[(E)-2-(diethylamino)ethenyl]-2,6-dimethylhept-5-enenitrile (PubChem CID 23266621) has the molecular formula C15H26N2 and a molecular weight of 234.39 g/mol. Its IUPAC name is 2-[(E)-2-(diethylamino)ethenyl]-2,6-dimethylhept-5-enenitrile.
| Compound Name | 2-[(E)-2-(diethylamino)ethenyl]-2,6-dimethylhept-5-enenitrile |
|---|---|
| PubChem CID | 23266621 |
| Molecular Formula | C15H26N2 |
| Molecular Weight | 234.39 g/mol |
| Exact Mass | 234.21 |
| IUPAC Name | 2-[(E)-2-(diethylamino)ethenyl]-2,6-dimethylhept-5-enenitrile |
| SMILES | CCN(/C=C/C(C)(C#N)CCC=C(C)C)CC |
| InChI | InChI=1S/C15H26N2/c1-6-17(7-2)12-11-15(5,13-16)10-8-9-14(3)4/h9,11-12H,6-8,10H2,1-5H3/b12-11+ |
| InChIKey | JBMSLPHHMYEJDL-VAWYXSNFSA-N |
| XLogP | 4.12 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.39 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|