C19H35N — CID 123394667
(3S)-N,N-diethyl-3,7,11-trimethyldodeca-1,6,10-trien-1-amine (PubChem CID 123394667) has the molecular formula C19H35N and a molecular weight of 277.50 g/mol. Its IUPAC name is (3S)-N,N-diethyl-3,7,11-trimethyldodeca-1,6,10-trien-1-amine.
| Compound Name | (3S)-N,N-diethyl-3,7,11-trimethyldodeca-1,6,10-trien-1-amine |
|---|---|
| PubChem CID | 123394667 |
| Molecular Formula | C19H35N |
| Molecular Weight | 277.50 g/mol |
| Exact Mass | 277.28 |
| IUPAC Name | (3S)-N,N-diethyl-3,7,11-trimethyldodeca-1,6,10-trien-1-amine |
| SMILES | CCN(C=C[C@@H](C)CCC=C(C)CCC=C(C)C)CC |
| InChI | InChI=1S/C19H35N/c1-7-20(8-2)16-15-19(6)14-10-13-18(5)12-9-11-17(3)4/h11,13,15-16,19H,7-10,12,14H2,1-6H3/t19-/m0/s1 |
| InChIKey | JUHARBSJQFPJRH-IBGZPJMESA-N |
| XLogP | 5.95 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.50 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|