C10H20O3 — CID 10976249
(2R,3R)-3,7-dimethyloct-6-ene-1,2,3-triol (PubChem CID 10976249) has the molecular formula C10H20O3 and a molecular weight of 188.27 g/mol. Its IUPAC name is (2R,3R)-3,7-dimethyloct-6-ene-1,2,3-triol.
| Compound Name | (2R,3R)-3,7-dimethyloct-6-ene-1,2,3-triol |
|---|---|
| PubChem CID | 10976249 |
| Molecular Formula | C10H20O3 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.14 |
| IUPAC Name | (2R,3R)-3,7-dimethyloct-6-ene-1,2,3-triol |
| SMILES | CC(C)=CCC[C@@](C)(O)[C@H](O)CO |
| InChI | InChI=1S/C10H20O3/c1-8(2)5-4-6-10(3,13)9(12)7-11/h5,9,11-13H,4,6-7H2,1-3H3/t9-,10-/m1/s1 |
| InChIKey | AAUZPDAUBFXASQ-NXEZZACHSA-N |
| XLogP | 0.84 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|