C30H46O2 — CID 54543374
2,6,10,15,19,23-hexamethyltetracosa-1,6,18,22-tetraen-11,13-diyne-10,15-diol (PubChem CID 54543374) has the molecular formula C30H46O2 and a molecular weight of 438.70 g/mol. Its IUPAC name is 2,6,10,15,19,23-hexamethyltetracosa-1,6,18,22-tetraen-11,13-diyne-10,15-diol.
| Compound Name | 2,6,10,15,19,23-hexamethyltetracosa-1,6,18,22-tetraen-11,13-diyne-10,15-diol |
|---|---|
| PubChem CID | 54543374 |
| Molecular Formula | C30H46O2 |
| Molecular Weight | 438.70 g/mol |
| Exact Mass | 438.35 |
| IUPAC Name | 2,6,10,15,19,23-hexamethyltetracosa-1,6,18,22-tetraen-11,13-diyne-10,15-diol |
| SMILES | C=C(C)CCCC(C)=CCCC(C)(O)C#CC#CC(C)(O)CCC=C(C)CCC=C(C)C |
| InChI | InChI=1S/C30H46O2/c1-25(2)15-11-17-27(5)19-13-23-29(7,31)21-9-10-22-30(8,32)24-14-20-28(6)18-12-16-26(3)4/h16,19-20,31-32H,1,11-15,17-18,23-24H2,2-8H3 |
| InChIKey | ZEUYHGJHJIRRPW-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.70 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|