C10H18O — CID 10953746
(2R)-7-methyl-3-methylideneoct-6-en-2-ol (PubChem CID 10953746) has the molecular formula C10H18O and a molecular weight of 154.25 g/mol. Its IUPAC name is (2R)-7-methyl-3-methylideneoct-6-en-2-ol.
| Compound Name | (2R)-7-methyl-3-methylideneoct-6-en-2-ol |
|---|---|
| PubChem CID | 10953746 |
| Molecular Formula | C10H18O |
| Molecular Weight | 154.25 g/mol |
| Exact Mass | 154.14 |
| IUPAC Name | (2R)-7-methyl-3-methylideneoct-6-en-2-ol |
| SMILES | C=C(CCC=C(C)C)[C@@H](C)O |
| InChI | InChI=1S/C10H18O/c1-8(2)6-5-7-9(3)10(4)11/h6,10-11H,3,5,7H2,1-2,4H3/t10-/m1/s1 |
| InChIKey | URZOUGUGOPLPAO-SNVBAGLBSA-N |
| XLogP | 2.67 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.25 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|