C30H50O2 — CID 52929831
(6E,10E,14E)-18-hydroperoxy-2,6,10,15,23-pentamethyl-19-methylidenetetracosa-2,6,10,14,22-pentaene (PubChem CID 52929831) has the molecular formula C30H50O2 and a molecular weight of 442.73 g/mol. Its IUPAC name is (6E,10E,14E)-18-hydroperoxy-2,6,10,15,23-pentamethyl-19-methylidenetetracosa-2,6,10,14,22-pentaene.
| Compound Name | (6E,10E,14E)-18-hydroperoxy-2,6,10,15,23-pentamethyl-19-methylidenetetracosa-2,6,10,14,22-pentaene |
|---|---|
| PubChem CID | 52929831 |
| Molecular Formula | C30H50O2 |
| Molecular Weight | 442.73 g/mol |
| Exact Mass | 442.38 |
| IUPAC Name | (6E,10E,14E)-18-hydroperoxy-2,6,10,15,23-pentamethyl-19-methylidenetetracosa-2,6,10,14,22-pentaene |
| SMILES | C=C(CCC=C(C)C)C(CC/C(C)=C/CC/C=C(\C)CC/C=C(\C)CCC=C(C)C)OO |
| InChI | InChI=1S/C30H50O2/c1-24(2)14-11-18-27(6)20-13-19-26(5)16-9-10-17-28(7)22-23-30(32-31)29(8)21-12-15-25(3)4/h14-17,20,30-31H,8-13,18-19,21-23H2,1-7H3/b26-16+,27-20+,28-17+ |
| InChIKey | ZOEQVCRDNZMIKZ-HKWLGGFDSA-N |
| XLogP | 10.07 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.73 |
| LogP ≤ 5 | 10.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|