C10H18O3 — CID 76711660
6-hydroperoxy-3,7-dimethylocta-2,7-dien-1-ol (PubChem CID 76711660) has the molecular formula C10H18O3 and a molecular weight of 186.25 g/mol. Its IUPAC name is 6-hydroperoxy-3,7-dimethylocta-2,7-dien-1-ol.
| Compound Name | 6-hydroperoxy-3,7-dimethylocta-2,7-dien-1-ol |
|---|---|
| PubChem CID | 76711660 |
| Molecular Formula | C10H18O3 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.13 |
| IUPAC Name | 6-hydroperoxy-3,7-dimethylocta-2,7-dien-1-ol |
| SMILES | C=C(C)C(CCC(C)=CCO)OO |
| InChI | InChI=1S/C10H18O3/c1-8(2)10(13-12)5-4-9(3)6-7-11/h6,10-12H,1,4-5,7H2,2-3H3 |
| InChIKey | RGTKRAAJKRHHDL-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|