C13H23ClO3 — CID 71331223
6-chloro-3,7-dimethylocta-2,7-dien-1-ol;propanoic acid (PubChem CID 71331223) has the molecular formula C13H23ClO3 and a molecular weight of 262.78 g/mol. Its IUPAC name is 6-chloro-3,7-dimethylocta-2,7-dien-1-ol;propanoic acid.
| Compound Name | 6-chloro-3,7-dimethylocta-2,7-dien-1-ol;propanoic acid |
|---|---|
| PubChem CID | 71331223 |
| Molecular Formula | C13H23ClO3 |
| Molecular Weight | 262.78 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | 6-chloro-3,7-dimethylocta-2,7-dien-1-ol;propanoic acid |
| SMILES | C=C(C)C(Cl)CCC(C)=CCO.CCC(=O)O |
| InChI | InChI=1S/C10H17ClO.C3H6O2/c1-8(2)10(11)5-4-9(3)6-7-12;1-2-3(4)5/h6,10,12H,1,4-5,7H2,2-3H3;2H2,1H3,(H,4,5) |
| InChIKey | GMJLIXKMFNDLNY-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.78 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|