C10H18O5 — CID 102244912
2,6-dihydroperoxy-7-methyl-3-methylideneoct-7-en-1-ol (PubChem CID 102244912) has the molecular formula C10H18O5 and a molecular weight of 218.25 g/mol. Its IUPAC name is 2,6-dihydroperoxy-7-methyl-3-methylideneoct-7-en-1-ol.
| Compound Name | 2,6-dihydroperoxy-7-methyl-3-methylideneoct-7-en-1-ol |
|---|---|
| PubChem CID | 102244912 |
| Molecular Formula | C10H18O5 |
| Molecular Weight | 218.25 g/mol |
| Exact Mass | 218.12 |
| IUPAC Name | 2,6-dihydroperoxy-7-methyl-3-methylideneoct-7-en-1-ol |
| SMILES | C=C(C)C(CCC(=C)C(CO)OO)OO |
| InChI | InChI=1S/C10H18O5/c1-7(2)9(14-12)5-4-8(3)10(6-11)15-13/h9-13H,1,3-6H2,2H3 |
| InChIKey | HPRDCUBLLAYXFZ-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.25 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|