C20H24O6 — CID 162903063
4-[6-hydroperoxy-3-(hydroxymethyl)-7-methylocta-2,7-dienoxy]-5-methylchromen-2-one (PubChem CID 162903063) has the molecular formula C20H24O6 and a molecular weight of 360.41 g/mol. Its IUPAC name is 4-[6-hydroperoxy-3-(hydroxymethyl)-7-methylocta-2,7-dienoxy]-5-methylchromen-2-one.
| Compound Name | 4-[6-hydroperoxy-3-(hydroxymethyl)-7-methylocta-2,7-dienoxy]-5-methylchromen-2-one |
|---|---|
| PubChem CID | 162903063 |
| Molecular Formula | C20H24O6 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | 4-[6-hydroperoxy-3-(hydroxymethyl)-7-methylocta-2,7-dienoxy]-5-methylchromen-2-one |
| SMILES | C=C(C)C(CCC(=CCOc1cc(=O)oc2cccc(C)c12)CO)OO |
| InChI | InChI=1S/C20H24O6/c1-13(2)16(26-23)8-7-15(12-21)9-10-24-18-11-19(22)25-17-6-4-5-14(3)20(17)18/h4-6,9,11,16,21,23H,1,7-8,10,12H2,2-3H3 |
| InChIKey | IYTCEJNETYVSPC-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|