C20H22O4 — CID 163015441
5-methyl-4-[2-[(5R)-5-(2-methylprop-1-enyl)oxolan-3-ylidene]ethoxy]chromen-2-one (PubChem CID 163015441) has the molecular formula C20H22O4 and a molecular weight of 326.39 g/mol. Its IUPAC name is 5-methyl-4-[2-[(5R)-5-(2-methylprop-1-enyl)oxolan-3-ylidene]ethoxy]chromen-2-one.
| Compound Name | 5-methyl-4-[2-[(5R)-5-(2-methylprop-1-enyl)oxolan-3-ylidene]ethoxy]chromen-2-one |
|---|---|
| PubChem CID | 163015441 |
| Molecular Formula | C20H22O4 |
| Molecular Weight | 326.39 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | 5-methyl-4-[2-[(5R)-5-(2-methylprop-1-enyl)oxolan-3-ylidene]ethoxy]chromen-2-one |
| SMILES | CC(C)=C[C@H]1CC(=CCOc2cc(=O)oc3cccc(C)c23)CO1 |
| InChI | InChI=1S/C20H22O4/c1-13(2)9-16-10-15(12-23-16)7-8-22-18-11-19(21)24-17-6-4-5-14(3)20(17)18/h4-7,9,11,16H,8,10,12H2,1-3H3/t16-/m0/s1 |
| InChIKey | QYSKIBOKWALCSP-INIZCTEOSA-N |
| XLogP | 4.16 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.39 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|