C8H16O3 — CID 101416470
(3S,4S)-3-hydroperoxy-2-methylhept-1-en-4-ol (PubChem CID 101416470) has the molecular formula C8H16O3 and a molecular weight of 160.21 g/mol. Its IUPAC name is (3S,4S)-3-hydroperoxy-2-methylhept-1-en-4-ol.
| Compound Name | (3S,4S)-3-hydroperoxy-2-methylhept-1-en-4-ol |
|---|---|
| PubChem CID | 101416470 |
| Molecular Formula | C8H16O3 |
| Molecular Weight | 160.21 g/mol |
| Exact Mass | 160.11 |
| IUPAC Name | (3S,4S)-3-hydroperoxy-2-methylhept-1-en-4-ol |
| SMILES | C=C(C)[C@H](OO)[C@@H](O)CCC |
| InChI | InChI=1S/C8H16O3/c1-4-5-7(9)8(11-10)6(2)3/h7-10H,2,4-5H2,1,3H3/t7-,8-/m0/s1 |
| InChIKey | JBBWLFINJCUDIH-YUMQZZPRSA-N |
| XLogP | 1.58 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.21 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|